For research use only. Not for therapeutic Use.
(R)-VX-11e(CAT: I040626) is a potent and selective inhibitor of extracellular signal-regulated kinase 2 (ERK2), part of the MAPK/ERK signaling cascade involved in cell proliferation, survival, and differentiation. As the (R)-enantiomer, it demonstrates enhanced potency and stereospecific binding to ERK2, making it a valuable tool for dissecting ERK-mediated signaling pathways. (R)-VX-11e is widely used in cancer research, particularly for studying resistance mechanisms to upstream RAF or MEK inhibitors and exploring ERK-dependent transcriptional regulation. Its specificity and robust cellular activity support preclinical evaluations of targeted therapies.
| CAS Number | 1680187-43-2 |
| Synonyms | 4-[2-(2-chloro-4-fluoroanilino)-5-methylpyrimidin-4-yl]-N-[(1R)-1-(3-chlorophenyl)-2-hydroxyethyl]-1H-pyrrole-2-carboxamide |
| Molecular Formula | C24H20Cl2FN5O2 |
| Purity | ≥95% |
| IUPAC Name | 4-[2-(2-chloro-4-fluoroanilino)-5-methylpyrimidin-4-yl]-N-[(1R)-1-(3-chlorophenyl)-2-hydroxyethyl]-1H-pyrrole-2-carboxamide |
| InChI | InChI=1S/C24H20Cl2FN5O2/c1-13-10-29-24(31-19-6-5-17(27)9-18(19)26)32-22(13)15-8-20(28-11-15)23(34)30-21(12-33)14-3-2-4-16(25)7-14/h2-11,21,28,33H,12H2,1H3,(H,30,34)(H,29,31,32)/t21-/m0/s1 |
| InChIKey | WUTVMXLIGHTZJC-NRFANRHFSA-N |
| SMILES | CC1=CN=C(N=C1C2=CNC(=C2)C(=O)NC(CO)C3=CC(=CC=C3)Cl)NC4=C(C=C(C=C4)F)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
