For research use only. Not for therapeutic Use.
R-PSOP（Cat No.:I045184）is a potent, selective antagonist of the P2Y1 receptor, a G protein–coupled receptor activated by adenosine diphosphate (ADP) and involved in platelet aggregation and thrombosis. By blocking P2Y1 signaling, R-PSOP inhibits platelet activation and reduces thrombus formation without significantly affecting normal hemostasis. It is a valuable research tool for studying purinergic signaling, platelet biology, and cardiovascular disease mechanisms. R-PSOP holds therapeutic potential for developing novel antithrombotic agents aimed at preventing stroke, myocardial infarction, and other thromboembolic disorders while minimizing bleeding risk associated with traditional anticoagulants.
| CAS Number | 1185189-97-2 |
| Synonyms | 1-phenyl-3-[(3R)-spiro[1-azabicyclo[2.2.2]octane-3,2′-3H-furo[2,3-b]pyridine]-5′-yl]urea |
| Molecular Formula | C20H22N4O2 |
| Purity | ≥95% |
| IUPAC Name | 1-phenyl-3-[(3R)-spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]pyridine]-5'-yl]urea |
| InChI | InChI=1S/C20H22N4O2/c25-19(22-16-4-2-1-3-5-16)23-17-10-14-11-20(26-18(14)21-12-17)13-24-8-6-15(20)7-9-24/h1-5,10,12,15H,6-9,11,13H2,(H2,22,23,25)/t20-/m0/s1 |
| InChIKey | BUOWEYLLAFLKCW-FQEVSTJZSA-N |
| SMILES | C1CN2CCC1[C@@]3(C2)CC4=C(O3)N=CC(=C4)NC(=O)NC5=CC=CC=C5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
