For research use only. Not for therapeutic Use.
(R)-Nicardipine(CAT: I017405) is the enantiomer of nicardipine, a dihydropyridine calcium channel blocker that selectively inhibits L-type voltage-gated calcium channels. While the racemic form of nicardipine is widely used as an antihypertensive and anti-anginal agent, the (R)-enantiomer allows researchers to study stereoselective pharmacological effects on vascular smooth muscle relaxation and calcium influx modulation. (R)-Nicardipine serves as a valuable reference compound in enantiomeric separation, cardiovascular pharmacology, and drug metabolism studies. Its use supports investigations into calcium signaling, stereoselective drug action, and the development of safer and more effective cardiovascular therapeutics.
| CAS Number | 76093-35-1 |
| Synonyms | 5-O-[2-[benzyl(methyl)amino]ethyl] 3-O-methyl (4R)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| Molecular Formula | C26H29N3O6 |
| Purity | ≥95% |
| IUPAC Name | 5-O-[2-[benzyl(methyl)amino]ethyl] 3-O-methyl (4R)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| InChI | InChI=1S/C26H29N3O6/c1-17-22(25(30)34-4)24(20-11-8-12-21(15-20)29(32)33)23(18(2)27-17)26(31)35-14-13-28(3)16-19-9-6-5-7-10-19/h5-12,15,24,27H,13-14,16H2,1-4H3/t24-/m1/s1 |
| InChIKey | ZBBHBTPTTSWHBA-XMMPIXPASA-N |
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OCCN(C)CC2=CC=CC=C2)C3=CC(=CC=C3)[N+](=O)[O-])C(=O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
