For research use only. Not for therapeutic Use.
(R)-(+)-N-Benzyl-1-phenylethylamine(Cat No.:R018349)is a chiral secondary amine featuring both benzyl and phenylethyl substituents, making it a valuable intermediate in asymmetric synthesis and chiral resolution. Its rigid, stereodefined structure is particularly useful in the preparation of enantiomerically pure compounds, including pharmaceuticals and ligands for asymmetric catalysis. This compound is often employed in the synthesis of bioactive molecules, where stereoselectivity is critical. With excellent solubility in organic solvents and a well-defined (R)-configuration, it offers high utility in stereocontrolled transformations and advanced synthetic methodologies.
| CAS Number | 38235-77-7 |
| Synonyms | (αR)-α-Methyl-N-(phenylmethyl)benzenemethanamine; (+)-Benzylphenethylamine; (+)-N-Benzyl-1-phenylethylamine; (+)-N-Benzyl-α-phenylethylamine; (R)-(+)-N-Benzyl-α-methylbenzylamine; (R)-Benzyl(α-methylbenzyl)amine; (R)-N-(α-Methylbenzyl)-N-benzylamine |
| Molecular Formula | C15H17N |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (1R)-N-benzyl-1-phenylethanamine |
| InChI | InChI=1S/C15H17N/c1-13(15-10-6-3-7-11-15)16-12-14-8-4-2-5-9-14/h2-11,13,16H,12H2,1H3/t13-/m1/s1 |
| InChIKey | ZYZHMSJNPCYUTB-CYBMUJFWSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)NCC2=CC=CC=C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |