R-(+)-Lisuride hydrogen maleate(Cat No.:M002341) is a salt form of lisuride, a potent dopamine receptor agonist used primarily in the treatment of Parkinson’s disease and to manage symptoms associated with prolactin-related disorders, such as hyperprolactinemia. This compound is also investigated for its potential use in treating migraine headaches due to its ability to modulate neurotransmitter activity. The R-(+) form specifies the active enantiomer of lisuride, which is more effective in targeting dopamine receptors. The addition of maleate improves the solubility and stability of the drug, enhancing its bioavailability and therapeutic efficacy.
Catalog Number | M002341 |
CAS Number | 19875-60-6 |
Molecular Formula | C24H30N4O5 |
Purity | 95% |
Storage | Desiccate at RT |
IUPAC Name | 3-[(6aR,9S)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea;(Z)-but-2-enedioic acid |
InChI | InChI=1S/C20H26N4O.C4H4O4/c1-4-24(5-2)20(25)22-14-10-16-15-7-6-8-17-19(15)13(11-21-17)9-18(16)23(3)12-14;5-3(6)1-2-4(7)8/h6-8,10-11,14,18,21H,4-5,9,12H2,1-3H3,(H,22,25);1-2H,(H,5,6)(H,7,8)/b;2-1-/t14-,18+;/m0./s1 |
InChIKey | CVQFAMQDTWVJSV-BAXNFHPCSA-N |
SMILES | CCN(CC)C(=O)NC1CN(C2CC3=CNC4=CC=CC(=C34)C2=C1)C.C(=CC(=O)O)C(=O)O |