For research use only. Not for therapeutic Use.
(R)-4-Hydroxythiochroman 1,1-dioxide(Cat No.:L007294), is a chemical compound. This compound belongs to the class of organic compounds known as chroman, which are compounds containing a chroman moiety, a bicyclic compound consisting of a benzene ring fused to a 2,2-dimethyl pyran. This specific thiochroman derivative exhibits a hydroxy group (-OH) and a sulfur dioxide group (-SO2) in its structure, giving it unique chemical properties. Researchers might utilize this compound in various fields such as medicinal chemistry or material science for its specific structural features.
CAS Number | 1308650-41-0 |
Molecular Formula | C9H10O3S |
Purity | ≥95% |
IUPAC Name | (4R)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-ol |
InChI | InChI=1S/C9H10O3S/c10-8-5-6-13(11,12)9-4-2-1-3-7(8)9/h1-4,8,10H,5-6H2/t8-/m1/s1 |
InChIKey | HDWSBBCZEGJIPK-MRVPVSSYSA-N |
SMILES | C1CS(=O)(=O)C2=CC=CC=C2C1O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |