For research use only. Not for therapeutic Use.
R-3-(N-Benzyloxycarbonylpyrrolidin-2-ylcarbonyl)-5-bromo-1H-indole (Cat No.: R005287) is a complex chiral molecule featuring an indole core substituted with a bromo group at the 5-position and a pyrrolidinylcarbonyl side chain protected by a benzyloxycarbonyl (Cbz) group. This compound is used as a synthetic intermediate in the development of bioactive molecules, particularly in peptide-based or indole-containing drug candidates. The presence of both a stereocenter and multiple functional groups makes it suitable for structure-activity relationship (SAR) studies in medicinal chemistry, especially targeting neurological or oncological pathways.
| CAS Number | 143322-56-9 |
| Synonyms | (2R)-2-[(5-Bromo-1H-indol-3-yl)carbonyl]-1-pyrrolidinecarboxylic Acid Phenylmethyl Ester; |
| Molecular Formula | C21H19BrN2O3 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | benzyl (2R)-2-(5-bromo-1H-indole-3-carbonyl)pyrrolidine-1-carboxylate |
| InChI | InChI=1S/C21H19BrN2O3/c22-15-8-9-18-16(11-15)17(12-23-18)20(25)19-7-4-10-24(19)21(26)27-13-14-5-2-1-3-6-14/h1-3,5-6,8-9,11-12,19,23H,4,7,10,13H2/t19-/m1/s1 |
| InChIKey | CWHKVBJSRGJFFN-LJQANCHMSA-N |
| SMILES | C1CC(N(C1)C(=O)OCC2=CC=CC=C2)C(=O)C3=CNC4=C3C=C(C=C4)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |