For research use only. Not for therapeutic Use.
(R)-3-(1-aminoethyl)aniline hydrochloride (Cat.No:L003687) is a significant chiral compound in pharmaceutical research. Its enantiopure form holds promise for the development of biologically active molecules, particularly in the field of medicinal chemistry. This compound’s unique stereochemistry and aminoethyl group make it a pivotal building block in the synthesis of novel pharmaceutical agents, emphasizing its importance in the quest for innovative drug candidates and its potential impact on the pharmaceutical industry.
CAS Number | 1391439-77-2 |
Molecular Formula | C8H13ClN2 |
Purity | ≥95% |
IUPAC Name | 3-[(1R)-1-aminoethyl]aniline;hydrochloride |
InChI | InChI=1S/C8H12N2.ClH/c1-6(9)7-3-2-4-8(10)5-7;/h2-6H,9-10H2,1H3;1H/t6-;/m1./s1 |
InChIKey | GLWBUAHIPLTXIQ-FYZOBXCZSA-N |
SMILES | C[C@H](C1=CC(=CC=C1)N)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |