For research use only. Not for therapeutic Use.
(R)-2-Amino-2-(o-tolyl)ethan-1-ol hydrochloride (Cat.No:L004092) is a significant chiral compound with diverse applications in pharmaceutical research. Its enantiopure nature and unique structure make it a valuable building block for the synthesis of specialized pharmaceuticals, particularly in the development of selective ligands and bioactive molecules.
| CAS Number | 1391592-93-0 |
| Molecular Formula | C9H14ClNO |
| Purity | ≥95% |
| IUPAC Name | (2R)-2-amino-2-(2-methylphenyl)ethanol;hydrochloride |
| InChI | InChI=1S/C9H13NO.ClH/c1-7-4-2-3-5-8(7)9(10)6-11;/h2-5,9,11H,6,10H2,1H3;1H/t9-;/m0./s1 |
| InChIKey | XRCVRMHELDJLFA-FVGYRXGTSA-N |
| SMILES | CC1=CC=CC=C1[C@H](CO)N.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
