For research use only. Not for therapeutic Use.
(R)-2-(1-Aminoethyl)-4-fluorophenol hydrochloride (Cat.No:L004040) is a crucial compound in pharmaceutical research. Its unique chiral structure, along with a fluorophenol group, imparts distinctive pharmacological properties. This compound is utilized as a key intermediate in the synthesis of specialized pharmaceutical agents, particularly in the field of drug development.
CAS Number | 1802222-53-2 |
Molecular Formula | C8H11ClFNO |
Purity | ≥95% |
IUPAC Name | 2-[(1R)-1-aminoethyl]-4-fluorophenol;hydrochloride |
InChI | InChI=1S/C8H10FNO.ClH/c1-5(10)7-4-6(9)2-3-8(7)11;/h2-5,11H,10H2,1H3;1H/t5-;/m1./s1 |
InChIKey | WNTRCWFPNVNFGW-NUBCRITNSA-N |
SMILES | C[C@H](C1=C(C=CC(=C1)F)O)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |