For research use only. Not for therapeutic Use.
(R)-1-N-Boc-3-methanesulfonyloxypiperidine（Cat No:L040779）is a chiral, protected piperidine derivative featuring a Boc (tert-butoxycarbonyl) group on the nitrogen atom and a methanesulfonyl (mesyl) group on the 3-position hydroxyl, forming a mesylate ester. The (R)-configuration imparts stereochemical control, making it useful in asymmetric synthesis and chiral drug development. The mesyl group is an excellent leaving group, enabling nucleophilic substitution reactions, while the Boc group provides protection under basic conditions and can be removed under mild acid. This compound is a key intermediate in synthesizing pharmaceuticals, fine chemicals, and biologically active piperidine-based structures.
| CAS Number | 404577-34-0 |
| Molecular Formula | C11H21NO5S |
| Purity | ≥95% |
| IUPAC Name | tert-butyl (3R)-3-methylsulfonyloxypiperidine-1-carboxylate |
| InChI | InChI=1S/C11H21NO5S/c1-11(2,3)16-10(13)12-7-5-6-9(8-12)17-18(4,14)15/h9H,5-8H2,1-4H3/t9-/m1/s1 |
| InChIKey | WLAZHMYDLUILKR-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](C1)OS(=O)(=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
