For research use only. Not for therapeutic Use.
QX77(Cat No.:I020063), a novel chaperone-mediated autophagy (CMA) activator, has been found to induce the upregulation of Rab11 and LAMP2A expression. This upregulation suggests that QX77 enhances CMA by promoting the expression of key proteins involved in CMA pathway regulation and cargo delivery. These findings highlight the potential of QX77 as a promising therapeutic agent for modulating CMA and promoting cellular clearance mechanisms.
| CAS Number | 1798331-92-6 |
| Molecular Formula | C₁₆H₁₃ClN₂O₂ |
| Purity | ≥95% |
| Target | Autophagy |
| Storage | Store at -20°C |
| IUPAC Name | N-[4-(7-chloro-2H-1,4-benzoxazin-3-yl)phenyl]acetamide |
| InChI | InChI=1S/C16H13ClN2O2/c1-10(20)18-13-5-2-11(3-6-13)15-9-21-16-8-12(17)4-7-14(16)19-15/h2-8H,9H2,1H3,(H,18,20) |
| InChIKey | PYCTUCLCTVWILY-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)C2=NC3=C(C=C(C=C3)Cl)OC2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |