For research use only. Not for therapeutic Use.
Quinacrine Hydrochloride(Cat No.:I008943)is an antiprotozoal and anthelmintic agent historically used to treat malaria, giardiasis, and other parasitic infections. It functions by intercalating into DNA, disrupting nucleic acid synthesis and parasite replication. Quinacrine also exhibits anti-inflammatory and immunomodulatory properties, making it useful in certain autoimmune conditions such as lupus erythematosus. Additionally, it has been explored in prion disease research for its potential to inhibit abnormal protein aggregation. Quinacrine Hydrochloride’s versatility and efficacy have made it a valuable tool in both clinical medicine and experimental pharmacology.
CAS Number | 69-05-6 |
Synonyms | SN 390; SN-390; SN390; ST 439; Acrichine; Acrinamine; Acriquine; AI3-04467; Quinacrine dihydrochloride; mepacrine dihydrochoride. trade name: atabrine.;N4-(6-chloro-2-methoxyacridin-9-yl)-N1,N1-diethylpentane-1,4-diamine dihydrochloride |
Molecular Formula | C23H32Cl3N3O |
Purity | ≥95% |
Target | Apoptosis |
Solubility | Soluble in DMSO, not soluble in water. |
Storage | 0 - 4 °C for short term, or -20 °C for long term |
IUPAC Name | 4-N-(6-chloro-2-methoxyacridin-9-yl)-1-N,1-N-diethylpentane-1,4-diamine;dihydrochloride |
InChI | InChI=1S/C23H30ClN3O.2ClH/c1-5-27(6-2)13-7-8-16(3)25-23-19-11-9-17(24)14-22(19)26-21-12-10-18(28-4)15-20(21)23;;/h9-12,14-16H,5-8,13H2,1-4H3,(H,25,26);2*1H |
InChIKey | UDKVBVICMUEIKS-UHFFFAOYSA-N |
SMILES | CCN(CC)CCCC(C)NC1=C2C=C(C=CC2=NC3=C1C=CC(=C3)Cl)OC.Cl.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |