For research use only. Not for therapeutic Use.
Quercetin 7-glucuronide(CAT: R055861) is a major glucuronidated metabolite of quercetin, a naturally occurring flavonoid with potent antioxidant, anti-inflammatory, and cardioprotective properties. This compound is commonly found in human plasma following the ingestion of quercetin-rich foods and serves as a bioactive form involved in various physiological processes. Quercetin 7-glucuronide exhibits enhanced solubility and stability, making it a valuable tool for studying flavonoid metabolism, bioavailability, and cellular signaling pathways. It plays a key role in vascular protection, immune modulation, and oxidative stress reduction, and is frequently used in pharmacokinetic and nutraceutical research.
| CAS Number | 38934-20-2 |
| Synonyms | (2S,3S,4S,5R,6S)-6-[2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| Molecular Formula | C21H18O13 |
| Purity | ≥95% |
| IUPAC Name | (2S,3S,4S,5R,6S)-6-[2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| InChI | InChI=1S/C21H18O13/c22-8-2-1-6(3-9(8)23)18-15(27)13(25)12-10(24)4-7(5-11(12)33-18)32-21-17(29)14(26)16(28)19(34-21)20(30)31/h1-5,14,16-17,19,21-24,26-29H,(H,30,31)/t14-,16-,17+,19-,21+/m0/s1 |
| InChIKey | JXWGCVLNCGCZRU-JENRNSKYSA-N |
| SMILES | C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)C(=O)O)O)O)O)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
