Quaterrylene(Cat No.:M071318) is a polycyclic aromatic hydrocarbon (PAH) composed of four fused benzene rings arranged in a rectangular shape. It is structurally similar to perylene but has an additional benzene ring, resulting in increased π-conjugation and electronic delocalization. Quaterrylene exhibits intriguing optical and electronic properties, including high fluorescence quantum yields and narrow emission spectra in the visible range. These properties make it valuable in applications such as organic semiconductors, light-emitting diodes (LEDs), and photovoltaic devices.
Catalog Number | M071318 |
CAS Number | 188-73-8 |
Molecular Formula | C40H20 |
Purity | 95% |
Storage | 3 years -20C powder |
IUPAC Name | undecacyclo[20.12.2.22,5.16,10.123,27.03,18.04,15.019,35.032,36.014,38.031,37]tetraconta-1(35),2,4,6,8,10(38),11,13,15,17,19,21,23,25,27(37),28,30,32(36),33,39-icosaene |
InChI | InChI=1S/C40H20/c1-5-21-6-2-10-24-28-14-18-32-34-20-16-30-26-12-4-8-22-7-3-11-25(36(22)26)29-15-19-33(40(34)38(29)30)31-17-13-27(37(28)39(31)32)23(9-1)35(21)24/h1-20H |
InChIKey | GGVMPKQSTZIOIU-UHFFFAOYSA-N |
SMILES | C1=CC2=C3C(=C1)C4=C5C(=CC=C6C5=C(C=C4)C7=C8C6=CC=C9C8=C(C=C7)C1=CC=CC4=C1C9=CC=C4)C3=CC=C2 |