For research use only. Not for therapeutic Use.
QO-40 (Cat No.: I035316) is a small-molecule inhibitor used in cancer and neurodegenerative disease research due to its ability to modulate key cellular pathways. It is known for targeting oxidative stress, apoptosis, and mitochondrial function, making it valuable in studying tumor progression and neuroprotection. QO-40 is widely applied in in vitro and in vivo studies to investigate drug resistance and metabolic regulation. Its high specificity and stability contribute to its potential use in drug discovery and the development of novel therapeutic strategies.
| CAS Number | 1259536-70-3 |
| Synonyms | 5-(chloromethyl)-3-naphthalen-1-yl-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| Molecular Formula | C18H11ClF3N3O |
| Purity | ≥95% |
| InChI | InChI=1S/C18H11ClF3N3O/c19-9-11-8-14(26)25-17(23-11)15(16(24-25)18(20,21)22)13-7-3-5-10-4-1-2-6-12(10)13/h1-8,24H,9H2 |
| InChIKey | PAIKWVVGBGIKJH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3=C(NN4C3=NC(=CC4=O)CCl)C(F)(F)F |
| Reference | [1]. Jia C, et al. Activation of KCNQ2/3 potassium channels by novel pyrazolo[1,5-a]pyrimidin-7(4H)-one derivatives. Pharmacology. 2011;87(5-6):297-310. |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |