For research use only. Not for therapeutic Use.
Qingyangshengenin(CAT: R024863) is a naturally occurring triterpenoid aglycone derived from plants of the Cynanchum genus, which are used in traditional Chinese medicine. As the core structure of several bioactive saponins, Qingyangshengenin has attracted interest for its potential pharmacological properties, including anti-inflammatory, anticancer, and hepatoprotective effects. Studies suggest it may influence cellular signaling pathways linked to apoptosis, oxidative stress, and immune regulation, making it relevant for research into chronic inflammation, liver injury, and cancer therapeutics. With its distinct triterpenoid skeleton, Qingyangshengenin also provides value in natural product chemistry and structure–activity relationship investigations for drug discovery and development.
| CAS Number | 84745-94-8 |
| Synonyms | [(3S,8S,9R,10R,12R,13S,14R,17S)-17-acetyl-3,8,14,17-tetrahydroxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] 4-hydroxybenzoate |
| Molecular Formula | C28H36O8 |
| Purity | ≥95% |
| IUPAC Name | [(3S,8S,9R,10R,12R,13S,14R,17S)-17-acetyl-3,8,14,17-tetrahydroxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] 4-hydroxybenzoate |
| InChI | InChI=1S/C28H36O8/c1-16(29)26(33)12-13-28(35)25(26,3)22(36-23(32)17-4-6-19(30)7-5-17)15-21-24(2)10-9-20(31)14-18(24)8-11-27(21,28)34/h4-8,20-22,30-31,33-35H,9-15H2,1-3H3/t20-,21+,22+,24-,25+,26+,27-,28+/m0/s1 |
| InChIKey | IMRGSWAJVVVYOW-ZCARJHNXSA-N |
| SMILES | CC(=O)C1(CCC2(C1(C(CC3C2(CC=C4C3(CCC(C4)O)C)O)OC(=O)C5=CC=C(C=C5)O)C)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
