For research use only. Not for therapeutic Use.
Q134R（Cat No.:I044396）is a small-molecule inhibitor designed to target and modulate the activity of specific proteins involved in disease-related signaling pathways, though its precise molecular target and therapeutic application may vary depending on research context. It is often used in preclinical studies to explore its impact on cell signaling, proliferation, and disease progression, particularly in oncology and immunology. Q134R exhibits cell permeability and favorable pharmacological properties, making it a valuable research tool for dissecting complex biological mechanisms and validating potential therapeutic targets in both in vitro and in vivo models.
| CAS Number | 2022949-46-6 |
| Synonyms | 7-[(R)-[(4-methylpyrimidin-2-yl)amino]-[4-(trifluoromethyl)phenyl]methyl]quinolin-8-ol |
| Molecular Formula | C22H17F3N4O |
| Purity | ≥95% |
| IUPAC Name | 7-[(R)-[(4-methylpyrimidin-2-yl)amino]-[4-(trifluoromethyl)phenyl]methyl]quinolin-8-ol |
| InChI | InChI=1S/C22H17F3N4O/c1-13-10-12-27-21(28-13)29-18(15-4-7-16(8-5-15)22(23,24)25)17-9-6-14-3-2-11-26-19(14)20(17)30/h2-12,18,30H,1H3,(H,27,28,29)/t18-/m1/s1 |
| InChIKey | PFCKQDHXCWWBSM-GOSISDBHSA-N |
| SMILES | CC1=NC(=NC=C1)N[C@H](C2=CC=C(C=C2)C(F)(F)F)C3=C(C4=C(C=CC=N4)C=C3)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
