Pyrrolo[1,2-a]pyrazine-8-carboxylic acid(Cat No.:L007635), is a chemical compound with a pyrrolopyrazine core and a carboxylic acid group at the 8-position. This unique molecular structure is significant in medicinal chemistry and drug discovery. Researchers use it as a scaffold for designing novel molecules with potential pharmaceutical applications. Its distinctive arrangement offers opportunities for chemical modifications, enabling the creation of diverse compounds for biological testing.
Catalog Number | L007635 |
CAS Number | 158945-78-9 |
Molecular Formula | C8H6N2O2 |
Purity | 95% |
Storage | Room Temperature |
IUPAC Name | pyrrolo[1,2-a]pyrazine-8-carboxylic acid |
InChI | InChI=1S/C8H6N2O2/c11-8(12)6-1-3-10-4-2-9-5-7(6)10/h1-5H,(H,11,12) |
InChIKey | HXNHJQXAQCRRHN-UHFFFAOYSA-N |
SMILES | C1=CN2C=CN=CC2=C1C(=O)O |