Pyridalyl(Cat No.:M039659), is a chemical compound used as a pesticide in agriculture. It belongs to the class of chemicals known as pyrazole insecticides. Pyridalyl is effective against various insect pests, particularly those that damage crops like fruits, vegetables, and cotton. It works by interfering with the nervous system of the target pests, ultimately leading to their paralysis and death. Pyridalyl is favored for its broad-spectrum activity and relatively low toxicity to humans and animals.
Catalog Number | M039659 |
CAS Number | 179101-81-6 |
Molecular Formula | C18H14Cl4F3NO3 |
Purity | 95% |
Storage | Store at -20C |
IUPAC Name | 2-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]-5-(trifluoromethyl)pyridine |
InChI | InChI=1S/C18H14Cl4F3NO3/c19-13-8-12(27-7-4-15(21)22)9-14(20)17(13)29-6-1-5-28-16-3-2-11(10-26-16)18(23,24)25/h2-4,8-10H,1,5-7H2 |
InChIKey | AEHJMNVBLRLZKK-UHFFFAOYSA-N |
SMILES | C1=CC(=NC=C1C(F)(F)F)OCCCOC2=C(C=C(C=C2Cl)OCC=C(Cl)Cl)Cl |