For research use only. Not for therapeutic Use.
Purpurogallin（Cat No.:I008912）is a naturally occurring benzotropolone derivative isolated from nutgalls and certain fungi. Known for its strong antioxidant, anti-inflammatory, and anticancer properties, it scavenges free radicals and protects against oxidative stress. Purpurogallin has been shown to inhibit enzymes such as xanthine oxidase and catechol-O-methyltransferase, contributing to its bioactivity. It also exhibits antimicrobial and cardioprotective effects, making it relevant in pharmacological research. Due to its polyphenolic structure, Purpurogallin is studied in contexts of cancer, neurodegeneration, and cardiovascular disease, highlighting its therapeutic and nutraceutical potential.
| CAS Number | 569-77-7 |
| Synonyms | 2,3,4,5-tetrahydroxybenzo[7]annulen-6-one |
| Molecular Formula | C11H8O5 |
| Purity | ≥95% |
| IUPAC Name | 2,3,4,6-tetrahydroxybenzo[7]annulen-5-one |
| InChI | InChI=1S/C11H8O5/c12-6-3-1-2-5-4-7(13)10(15)11(16)8(5)9(6)14/h1-4,13,15-16H,(H,12,14) |
| InChIKey | WDGFFVCWBZVLCE-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C(C(=C2C(=O)C(=C1)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
