For research use only. Not for therapeutic Use.
Pterostilbene (Cat No.: R026603) is a natural compound found in blueberries and grapes, closely related to resveratrol. It belongs to the stilbene class of phytoalexins and is known for its antioxidant, anti-inflammatory, and potential anticancer properties. Pterostilbene has been studied for its ability to promote heart health, reduce oxidative stress, and improve cognitive function. It is believed to have better bioavailability than resveratrol, making it potentially more effective as a supplement. However, more research is needed to confirm its full therapeutic benefits.
CAS Number | 537-42-8 |
Synonyms | (E)-2-(3,5-Dimethoxyphenyl)-1-(4-hydroxyphenyl)ethene; (E)-4-(3,5-Dimethoxystyryl)phenol; (E)-4-Hydroxy-3’,5’-dimethoxystilbene; 3,5-Dimethoxy-4’-hydroxy-trans-stilbene; Pterostilbene; trans-3,5-Dimethoxy-4’-hydroxystilbene; trans-Pterostilbene |
Molecular Formula | C16H16O3 |
Purity | ≥95% |
Target | Autophagy |
Storage | -20°C |
IUPAC Name | 4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenol |
InChI | InChI=1S/C16H16O3/c1-18-15-9-13(10-16(11-15)19-2)4-3-12-5-7-14(17)8-6-12/h3-11,17H,1-2H3/b4-3+ |
InChIKey | VLEUZFDZJKSGMX-ONEGZZNKSA-N |
SMILES | COC1=CC(=CC(=C1)C=CC2=CC=C(C=C2)O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |