1. Home
  2. Product
  3. Inhibitors/Agonists
  4. Pteropterin

Pteropterin - CAS 89-38-3

Pteropterin (CAT: I035181) is a naturally occurring compound and an intermediate in the biosynthesis of biopterin, a cofactor involved in various biological processes. Pteropterin is known for its role in the metabolism of folate, as it serves as a precursor in the synthesis of tetrahydrobiopterin (BH4), an important cofactor for the enzymes involved in the synthesis of neurotransmitters such as serotonin and dopamine. Additionally, pteropterin has been studied for its potential as a biomarker in certain diseases, including cancer and inflammatory conditions.

Catalog Number: I035181

CAS Number: 89-38-3

Molecular Formula: C29H33N9O12

Molecular Weight:699.63

Purity: 98.0%

Appearance:Solid powder

Online inquiry

* For research use only. Not for human or veterinary use.

Synonym

SynonymsPteropterin; Pteroyl triglutamic acid; PTGA; Teropterin; Folic acid diglutamate;

Property

Molecular Formula: C29H33N9O12
Molecular Weight699.63
SolubilitySoluble in DMSO
Purity98.0%
StorageDry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years).

Computed Descriptor

IUPAC Name((S)-4-((S)-4-(4-(((2-amino-4-oxo-1,4-dihydropteridin-6-yl)methyl)amino)benzamido)-4-carboxybutanamido)-4-carboxybutanoyl)-L-glutamic acid
InChIInChI=1S/C29H33N9O12/c30-29-37-23-22(25(44)38-29)33-15(12-32-23)11-31-14-3-1-13(2-4-14)24(43)36-18(28(49)50)6-9-20(40)34-16(26(45)46)5-8-19(39)35-17(27(47)48)7-10-21(41)42/h1-4,12,16-18,31H,5-11H2,(H,34,40)(H,35,39)(H,36,43)(H,41,42)(H,45,46)(H,47,48)(H,49,50)(H3,30,32,37,38,44)/t16-,17-,18-/m0/s1
InChIKeyWOLQREOUPKZMEX-BZSNNMDCSA-N
SMILESO=C(O)CC[C@@H](C(O)=O)NC(CC[C@@H](C(O)=O)NC(CC[C@@H](C(O)=O)NC(C1=CC=C(NCC2=CN=C3NC(N)=NC(C3=N2)=O)C=C1)=O)=O)=O