For research use only. Not for therapeutic Use.
PT-179 (Cat No.: I040012) is a novel small-molecule inhibitor targeting mutant KRAS, a key oncogenic driver in various cancers, including lung, colorectal, and pancreatic cancers. By selectively inhibiting KRAS signaling, PT-179 disrupts tumor growth and survival pathways, offering potential therapeutic insights for KRAS-driven malignancies. Its specificity and potency make it a valuable research tool for studying targeted cancer therapies and resistance mechanisms. PT-179 provides new opportunities in oncology drug discovery, particularly in overcoming challenges associated with KRAS-mutant tumor treatment.
| CAS Number | 2924858-25-1 |
| Synonyms | 2-(2,6-dioxopiperidin-3-yl)-5-morpholin-4-ylisoindole-1,3-dione |
| Molecular Formula | C17H17N3O5 |
| Purity | ≥95% |
| InChI | InChI=1S/C17H17N3O5/c21-14-4-3-13(15(22)18-14)20-16(23)11-2-1-10(9-12(11)17(20)24)19-5-7-25-8-6-19/h1-2,9,13H,3-8H2,(H,18,21,22) |
| InChIKey | CCCSRHUSXCBFJZ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)N4CCOCC4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |