For research use only. Not for therapeutic Use.
Psora-4（Cat No.:R058510）is a small molecule inhibitor that targets the transient receptor potential vanilloid 4 (TRPV4) ion channel, which plays a key role in cellular responses to mechanical stress and osmotic changes. By inhibiting TRPV4, Psora-4 has shown potential in reducing inflammation and modulating pain responses. It is being investigated for its therapeutic applications in conditions such as psoriasis, osteoarthritis, and other inflammatory diseases. Early research suggests Psora-4 may help manage these conditions by reducing the overactivation of TRPV4 channels, although further clinical trials are needed to confirm its safety and efficacy.
| CAS Number | 724709-68-6 |
| Synonyms | 4-(4-phenylbutoxy)furo[3,2-g]chromen-7-one |
| Molecular Formula | C21H18O4 |
| Purity | ≥95% |
| IUPAC Name | 4-(4-phenylbutoxy)furo[3,2-g]chromen-7-one |
| InChI | InChI=1S/C21H18O4/c22-20-10-9-16-19(25-20)14-18-17(11-13-23-18)21(16)24-12-5-4-8-15-6-2-1-3-7-15/h1-3,6-7,9-11,13-14H,4-5,8,12H2 |
| InChIKey | JJAWGNIQEOFURP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCCCOC2=C3C=CC(=O)OC3=CC4=C2C=CO4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
