For research use only. Not for therapeutic Use.
PSEM 89S TFA (Cat No.:I015059) is a synthetic ligand developed for use in chemogenetics, specifically the PSAM/PSEM system (Pharmacologically Selective Actuator Modules/Pharmacologically Selective Effector Molecules). It selectively activates engineered ion channels without affecting endogenous receptors, allowing precise, reversible control of neuronal activity. PSEM 89S TFA exhibits high potency, water solubility, and excellent brain penetrance, making it suitable for in vivo neuroscience research. This ligand is widely used to study neural circuits, behavior, and brain disorders by enabling noninvasive, temporally controlled modulation of specific cell populations through designer receptors.
| CAS Number | 1336913-03-1 |
| Synonyms | N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2,5-dimethoxybenzamide;2,2,2-trifluoroacetic acid |
| Molecular Formula | C18H23F3N2O5 |
| Purity | ≥95% |
| IUPAC Name | N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2,5-dimethoxybenzamide;2,2,2-trifluoroacetic acid |
| InChI | InChI=1S/C16H22N2O3.C2HF3O2/c1-20-12-3-4-15(21-2)13(9-12)16(19)17-14-10-18-7-5-11(14)6-8-18;3-2(4,5)1(6)7/h3-4,9,11,14H,5-8,10H2,1-2H3,(H,17,19);(H,6,7)/t14-;/m1./s1 |
| InChIKey | GLKCNNXBIUCCJJ-PFEQFJNWSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)C(=O)N[C@@H]2CN3CCC2CC3.C(=O)(C(F)(F)F)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
