For research use only. Not for therapeutic Use.
PSB-SB-487（Cat No.:I043588）is a small molecule inhibitor that targets the protein kinase CK2 (casein kinase 2), an enzyme involved in regulating critical cellular processes such as cell growth, survival, and proliferation. CK2 is often overactive in various cancers and other diseases, contributing to tumor progression and resistance to treatment. By inhibiting CK2, PSB-SB-487 aims to disrupt oncogenic signaling pathways, potentially reducing tumor growth and enhancing the effectiveness of other therapies. This compound is being studied for its therapeutic applications in cancer and diseases characterized by CK2 dysregulation.
| CAS Number | 1399049-81-0 |
| Synonyms | 5-hydroxy-3-[(2-hydroxyphenyl)methyl]-7-(2-methylnonan-2-yl)chromen-2-one |
| Molecular Formula | C26H32O4 |
| Purity | ≥95% |
| IUPAC Name | 5-hydroxy-3-[(2-hydroxyphenyl)methyl]-7-(2-methylnonan-2-yl)chromen-2-one |
| InChI | InChI=1S/C26H32O4/c1-4-5-6-7-10-13-26(2,3)20-16-23(28)21-15-19(25(29)30-24(21)17-20)14-18-11-8-9-12-22(18)27/h8-9,11-12,15-17,27-28H,4-7,10,13-14H2,1-3H3 |
| InChIKey | YNWOMOUVWNKICO-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(C)(C)C1=CC(=C2C=C(C(=O)OC2=C1)CC3=CC=CC=C3O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
