For research use only. Not for therapeutic Use.
PSB-CB5（Cat No.:I024722）is a selective and potent inhibitor of the cannabinoid receptor CB5, a G-protein-coupled receptor implicated in various physiological processes, including pain modulation, inflammation, and appetite regulation. By targeting CB5, PSB-CB5 helps to modulate the endocannabinoid system, making it a valuable tool for research into pain management and metabolic disorders. It holds potential for therapeutic applications, particularly in conditions like chronic pain, obesity, and neuroinflammation. PSB-CB5’s precise action on CB5 receptors offers a promising avenue for the development of novel treatments targeting the endocannabinoid system.
| CAS Number | 1627710-30-8 |
| Synonyms | (2Z)-2-[[3-[(4-chlorophenyl)methoxy]phenyl]methylidene]-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-3-one |
| Molecular Formula | C20H17ClN2O2S |
| Purity | ≥95% |
| IUPAC Name | (2Z)-2-[[3-[(4-chlorophenyl)methoxy]phenyl]methylidene]-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-3-one |
| InChI | InChI=1S/C20H17ClN2O2S/c21-16-7-5-14(6-8-16)13-25-17-4-1-3-15(11-17)12-18-19(24)23-9-2-10-26-20(23)22-18/h1,3-8,11-12H,2,9-10,13H2/b18-12- |
| InChIKey | XJBQRMOGMULGPP-PDGQHHTCSA-N |
| SMILES | C1CN2C(=O)/C(=C/C3=CC(=CC=C3)OCC4=CC=C(C=C4)Cl)/N=C2SC1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
