For research use only. Not for therapeutic Use.
PSB-06126（Cat No.:I010585）is a selective small molecule inhibitor of the protein kinase CK1δ (casein kinase 1 delta), which is involved in regulating cellular processes like the cell cycle, circadian rhythm, and signaling pathways related to cancer progression. Dysregulation of CK1δ has been linked to various cancers and neurodegenerative disorders. By inhibiting CK1δ, PSB-06126 aims to block abnormal cell signaling, reducing tumor cell proliferation and potentially restoring normal cellular function. This compound is being studied for its therapeutic potential in oncology and other diseases where CK1δ plays a critical role in disease progression.
| CAS Number | 1052089-16-3 |
| Synonyms | sodium;1-amino-4-(naphthalen-1-ylamino)-9,10-dioxoanthracene-2-sulfonate |
| Molecular Formula | C24H15N2NaO5S |
| Purity | ≥95% |
| IUPAC Name | sodium;1-amino-4-(naphthalen-1-ylamino)-9,10-dioxoanthracene-2-sulfonate |
| InChI | InChI=1S/C24H16N2O5S.Na/c25-22-19(32(29,30)31)12-18(26-17-11-5-7-13-6-1-2-8-14(13)17)20-21(22)24(28)16-10-4-3-9-15(16)23(20)27;/h1-12,26H,25H2,(H,29,30,31);/q;+1/p-1 |
| InChIKey | BLOBABILSRPNHR-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C(=C1)C=CC=C2NC3=CC(=C(C4=C3C(=O)C5=CC=CC=C5C4=O)N)S(=O)(=O)[O-].[Na+] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
