For research use only. Not for therapeutic Use.
PS47（Cat No.:I035117）is a selective small-molecule inhibitor targeting the p47phox subunit of NADPH oxidase, an enzyme complex involved in the generation of reactive oxygen species (ROS). By disrupting the assembly of the NADPH oxidase complex, PS47 effectively reduces ROS production, which is implicated in oxidative stress and inflammation. It is particularly valuable in research exploring the role of ROS in cardiovascular diseases, neurodegeneration, and cancer. PS47 provides a targeted approach to modulate redox signaling pathways, making it a useful tool for studying oxidative stress-related cellular mechanisms and for evaluating potential antioxidant therapies.
| CAS Number | 1180676-33-8 |
| Synonyms | (E)-5-(4-chlorophenyl)-3-phenylpent-2-enoic acid |
| Molecular Formula | C17H15ClO2 |
| Purity | ≥95% |
| IUPAC Name | (E)-5-(4-chlorophenyl)-3-phenylpent-2-enoic acid |
| InChI | InChI=1S/C17H15ClO2/c18-16-10-7-13(8-11-16)6-9-15(12-17(19)20)14-4-2-1-3-5-14/h1-5,7-8,10-12H,6,9H2,(H,19,20)/b15-12+ |
| InChIKey | LLJYFDRQFPQGNY-NTCAYCPXSA-N |
| SMILES | C1=CC=C(C=C1)/C(=C/C(=O)O)/CCC2=CC=C(C=C2)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
