For research use only. Not for therapeutic Use.
Prothioconazole-desthio (Cat.No:M021339) is a derivative of the fungicide prothioconazole. It is a metabolite formed in plants and soil after prothioconazole application. Although less active against some fungi, it still contributes to the overall antifungal activity and is essential for understanding the environmental fate and effectiveness of prothioconazole in agriculture.
| CAS Number | 120983-64-4 |
| Molecular Formula | C14H15Cl2N3O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-(1-chlorocyclopropyl)-1-(2-chlorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol |
| InChI | InChI=1S/C14H15Cl2N3O/c15-12-4-2-1-3-11(12)7-14(20,13(16)5-6-13)8-19-10-17-9-18-19/h1-4,9-10,20H,5-8H2 |
| InChIKey | HHUQPWODPBDTLI-UHFFFAOYSA-N |
| SMILES | C1CC1(C(CC2=CC=CC=C2Cl)(CN3C=NC=N3)O)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
