For research use only. Not for therapeutic Use.
proTAME(Cat No.:I035094)is a cell-permeable small-molecule inhibitor that targets the Anaphase-Promoting Complex/Cyclosome (APC/C), a key E3 ubiquitin ligase regulating mitosis and cell cycle progression. As a prodrug of TAME (tosyl-L-arginine methyl ester), proTAME is converted intracellularly into its active form, which binds to the APC/C co-activators CDC20 and CDH1, preventing substrate recognition and ubiquitination. This inhibition arrests cells in mitosis, leading to mitotic defects and apoptosis, particularly in rapidly dividing cancer cells. proTAME is widely used in research to study cell cycle regulation and holds promise as an anti-cancer therapeutic strategy.
| CAS Number | 1362911-19-0 |
| Synonyms | methyl (2S)-5-[bis[(2-phenylacetyl)oxymethoxycarbonylamino]methylideneamino]-2-[(4-methylphenyl)sulfonylamino]pentanoate |
| Molecular Formula | C34H38N4O12S |
| Purity | ≥95% |
| IUPAC Name | methyl (2S)-5-[bis[(2-phenylacetyl)oxymethoxycarbonylamino]methylideneamino]-2-[(4-methylphenyl)sulfonylamino]pentanoate |
| InChI | InChI=1S/C34H38N4O12S/c1-24-15-17-27(18-16-24)51(44,45)38-28(31(41)46-2)14-9-19-35-32(36-33(42)49-22-47-29(39)20-25-10-5-3-6-11-25)37-34(43)50-23-48-30(40)21-26-12-7-4-8-13-26/h3-8,10-13,15-18,28,38H,9,14,19-23H2,1-2H3,(H2,35,36,37,42,43)/t28-/m0/s1 |
| InChIKey | MHYOVHULCQSDRZ-NDEPHWFRSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[C@@H](CCCN=C(NC(=O)OCOC(=O)CC2=CC=CC=C2)NC(=O)OCOC(=O)CC3=CC=CC=C3)C(=O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |