For research use only. Not for therapeutic Use.
PROTAC-O4I2（Cat No.:I045227）is a bifunctional proteolysis-targeting chimera (PROTAC) designed to induce targeted degradation of specific proteins via the ubiquitin–proteasome system. It contains a ligand for the protein of interest linked to an E3 ubiquitin ligase–recruiting moiety, connected by an optimized linker to ensure effective ternary complex formation. By bringing the target protein into proximity with the E3 ligase, PROTAC-O4I2 promotes ubiquitination and subsequent proteasomal degradation. This molecule is a valuable research tool for studying targeted protein degradation mechanisms and developing therapeutic strategies against diseases driven by pathogenic or overexpressed proteins.
| CAS Number | 2785323-62-6 |
| Synonyms | 2-(4-chloroanilino)-N-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexyl]-1,3-thiazole-4-carboxamide |
| Molecular Formula | C29H29ClN6O5S |
| Purity | ≥95% |
| IUPAC Name | 2-(4-chloroanilino)-N-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexyl]-1,3-thiazole-4-carboxamide |
| InChI | InChI=1S/C29H29ClN6O5S/c30-17-8-10-18(11-9-17)33-29-34-21(16-42-29)25(38)32-15-4-2-1-3-14-31-20-7-5-6-19-24(20)28(41)36(27(19)40)22-12-13-23(37)35-26(22)39/h5-11,16,22,31H,1-4,12-15H2,(H,32,38)(H,33,34)(H,35,37,39) |
| InChIKey | UWYLVQJEOCYCEW-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)NCCCCCCNC(=O)C4=CSC(=N4)NC5=CC=C(C=C5)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
