For research use only. Not for therapeutic Use.
PROTAC MDM2 Degrader-2(Cat No.:I018608), also known as Compound 9b, is a small molecule designed as a proteolysis-targeting chimera (PROTAC) for the degradation of MDM2, an oncogenic protein that promotes the degradation of p53 tumor suppressor. It acts by recruiting the E3 ubiquitin ligase, leading to ubiquitination and subsequent proteasomal degradation of MDM2. By promoting the degradation of MDM2, PROTAC MDM2 Degrader-2 can indirectly increase the levels of p53, which plays a critical role in regulating cell cycle arrest and apoptosis.
| CAS Number | 2249944-99-6 |
| Molecular Formula | C₇₀H₇₆Cl₄N₁₀O₁₂ |
| Purity | ≥95% |
| Target | Apoptosis |
| Storage | Store at -20°C |
| IUPAC Name | 2-[4-[(4R,5S)-4,5-bis(4-chlorophenyl)-2-(4-methoxy-2-propan-2-yloxyphenyl)-4,5-dihydroimidazole-1-carbonyl]-2-oxopiperazin-1-yl]-N-[2-[2-[2-[[2-[4-[(4R,5S)-4,5-bis(4-chlorophenyl)-2-(4-methoxy-2-propan-2-yloxyphenyl)-4,5-dihydroimidazole-1-carbonyl]-2-oxopiperazin-1-yl]acetyl]amino]ethoxy]ethoxy]ethyl]acetamide |
| InChI | InChI=1S/C70H76Cl4N10O12/c1-43(2)95-57-37-53(91-5)23-25-55(57)67-77-63(45-7-15-49(71)16-8-45)65(47-11-19-51(73)20-12-47)83(67)69(89)81-31-29-79(61(87)41-81)39-59(85)75-27-33-93-35-36-94-34-28-76-60(86)40-80-30-32-82(42-62(80)88)70(90)84-66(48-13-21-52(74)22-14-48)64(46-9-17-50(72)18-10-46)78-68(84)56-26-24-54(92-6)38-58(56)96-44(3)4/h7-26,37-38,43-44,63-66H,27-36,39-42H2,1-6H3,(H,75,85)(H,76,86)/t63-,64-,65+,66+/m1/s1 |
| InChIKey | WZLSSHVSGKCEKQ-AKOOKZATSA-N |
| SMILES | CC(C)OC1=C(C=CC(=C1)OC)C2=NC(C(N2C(=O)N3CCN(C(=O)C3)CC(=O)NCCOCCOCCNC(=O)CN4CCN(CC4=O)C(=O)N5C(C(N=C5C6=C(C=C(C=C6)OC)OC(C)C)C7=CC=C(C=C7)Cl)C8=CC=C(C=C8)Cl)C9=CC=C(C=C9)Cl)C1=CC=C(C=C1)Cl |
| Reference | [1]. Method of inducing of self-degradation of MDM2 using E3 ubiquitin ligase dimer amide small molecule PROTACs. CN108610333A. |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |