For research use only. Not for therapeutic Use.
Prostratin(Cat No.:R009993)is a natural compound derived from the Dalea villosa plant, known for its potential as an activator of protein kinase C (PKC). It has garnered attention for its ability to modulate immune responses and may have therapeutic applications in the treatment of viral infections, such as HIV, by reactivating latent virus reservoirs. Prostratin’s role in enhancing immune function and its potential to target cancer cells have also been explored. Ongoing research investigates its efficacy in treating diseases involving immune dysfunction, viral latency, and cancer, highlighting its promise in drug development.
| CAS Number | 60857-08-1 |
| Synonyms | [(1R,2S,6R,10S,11R,13S,15R)-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] acetate |
| Molecular Formula | C22H30O6 |
| Purity | ≥95% |
| IUPAC Name | [(1R,2S,6R,10S,11R,13S,15R)-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] acetate |
| InChI | InChI=1S/C22H30O6/c1-11-6-16-20(26,18(11)25)9-14(10-23)7-15-17-19(4,5)21(17,28-13(3)24)8-12(2)22(15,16)27/h6-7,12,15-17,23,26-27H,8-10H2,1-5H3/t12-,15+,16-,17-,20-,21+,22-/m1/s1 |
| InChIKey | BOJKFRKNLSCGHY-HXGSDTCMSA-N |
| SMILES | C[C@@H]1C[C@@]2([C@@H](C2(C)C)[C@H]3[C@]1([C@@H]4C=C(C(=O)[C@]4(CC(=C3)CO)O)C)O)OC(=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |