Prostaglandin D2-d4(Cat No.:R067209) is a deuterated form of Prostaglandin D2, where four hydrogen atoms are replaced with deuterium. This isotopic labeling enhances its chemical stability and resistance to metabolic breakdown, making it invaluable for biochemical and pharmacological studies. Prostaglandin D2 plays a crucial role in inflammatory processes and is a major mediator in allergic reactions. The deuterated variant, Prostaglandin D2-d4, allows for precise and detailed analysis of its metabolic pathways and interactions, aiding in the development of targeted treatments for inflammation and allergy-related conditions, such as asthma and allergic rhinitis.
Catalog Number | R067209 |
CAS Number | 211105-29-2 |
Synonyms | PGD2-d4 |
Molecular Formula | C20H28D4O5 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (Z)-3,3,4,4-tetradeuterio-7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]hept-5-enoic acid |
InChI | InChI=1S/C20H32O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,12-13,15-18,21-22H,2-3,5-6,8-11,14H2,1H3,(H,24,25)/b7-4-,13-12+/t15-,16+,17+,18-/m0/s1/i5D2,8D2 |
InChIKey | BHMBVRSPMRCCGG-DCNIGHKFSA-N |
SMILES | CCCCCC(C=CC1C(C(CC1=O)O)CC=CCCCC(=O)O)O |