For research use only. Not for therapeutic Use.
Prostaglandin B2 (Cat.No:M060452) is a non-<wbr></wbr>enzymatic dehydration product resulting from the treatment of PGE<sub>2</sub> or PGA<sub>2</sub> with strong base. It has weak agonist activity on TP receptors and can increase pulmonary blood pressure in the rabbit at relatively high doses (5 µg/kg).
| CAS Number | 13367-85-6 |
| Synonyms | PGB2 |
| Molecular Formula | C20H30O4 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | -20°C |
| IUPAC Name | (Z)-7-[2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopenten-1-yl]hept-5-enoic acid |
| InChI | InChI=1S/C20H30O4/c1-2-3-6-9-17(21)14-12-16-13-15-19(22)18(16)10-7-4-5-8-11-20(23)24/h4,7,12,14,17,21H,2-3,5-6,8-11,13,15H2,1H3,(H,23,24)/b7-4-,14-12+/t17-/m0/s1 |
| InChIKey | PRFXRIUZNKLRHM-HKVRTXJWSA-N |
| SMILES | CCCCCC(C=CC1=C(C(=O)CC1)CC=CCCCC(=O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |