For research use only. Not for therapeutic Use.
Propyl levulinate(CAT: R073889) is a chemical compound used primarily in the field of organic chemistry and as a flavoring agent in the food industry. Its action method involves its potential use as a flavoring component, particularly in food and beverage products, where it imparts a fruity, sweet aroma. Additionally, it may find applications in organic synthesis as a reagent or intermediate for the preparation of various organic compounds.
| CAS Number | 645-67-0 |
| Molecular Formula | C8H14O3 |
| Purity | ≥95% |
| IUPAC Name | propyl 4-oxopentanoate |
| InChI | InChI=1S/C8H14O3/c1-3-6-11-8(10)5-4-7(2)9/h3-6H2,1-2H3 |
| InChIKey | QOSMNYMQXIVWKY-UHFFFAOYSA-N |
| SMILES | CCCOC(=O)CCC(=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |