For research use only. Not for therapeutic Use.
Propoxycarbazone(Cat No.:M097283) is a synthetic herbicide commonly used in agriculture to control grassy weeds in cereal crops such as wheat and barley. It belongs to the chemical class of sulfonylureas, which function by inhibiting the enzyme acetolactate synthase (ALS). This enzyme is crucial for the synthesis of essential amino acids in plants, and its inhibition leads to the cessation of cell division and ultimately plant death. Propoxycarbazone is appreciated for its high specificity and efficacy, allowing for lower application rates and minimal impact on non-target vegetation, aligning with integrated weed management practices.
| CAS Number | 145026-81-9 |
| Molecular Formula | C15H18N4O7S |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | methyl 2-[(4-methyl-5-oxo-3-propoxy-1,2,4-triazole-1-carbonyl)sulfamoyl]benzoate |
| InChI | InChI=1S/C15H18N4O7S/c1-4-9-26-14-16-19(15(22)18(14)2)13(21)17-27(23,24)11-8-6-5-7-10(11)12(20)25-3/h5-8H,4,9H2,1-3H3,(H,17,21) |
| InChIKey | JTHMVYBOQLDDIY-UHFFFAOYSA-N |
| SMILES | CCCOC1=NN(C(=O)N1C)C(=O)NS(=O)(=O)C2=CC=CC=C2C(=O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |