Home
>
Chemical Reagents>Organic Building Blocks> Propiophenone, 3-(benzylmethylamino)-, hydrochloride
For research use only. Not for therapeutic Use.
Propiophenone, 3-(benzylmethylamino)-, hydrochloride(Cat No.:L007269), is a chemical compound used in various applications. It is a crystalline solid with a hydrochloride salt structure. This compound finds utility as a precursor and intermediate in organic synthesis, particularly in the pharmaceutical industry. Its versatile nature allows for its incorporation into complex molecules during drug development processes. Researchers utilize it for creating diverse pharmaceutical agents and investigational drugs, emphasizing its significance in medicinal chemistry. Additionally, its stable crystalline form and compatibility with other reagents make it valuable in laboratory settings for chemical synthesis and related research endeavors.
| CAS Number | 5409-62-1 |
| Molecular Formula | C17H20ClNO |
| Purity | ≥95% |
| IUPAC Name | 3-[benzyl(methyl)amino]-1-phenylpropan-1-one;hydrochloride |
| InChI | InChI=1S/C17H19NO.ClH/c1-18(14-15-8-4-2-5-9-15)13-12-17(19)16-10-6-3-7-11-16;/h2-11H,12-14H2,1H3;1H |
| InChIKey | UQMCPHGYLMSEPN-UHFFFAOYSA-N |
| SMILES | CN(CCC(=O)C1=CC=CC=C1)CC2=CC=CC=C2.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |