For research use only. Not for therapeutic Use.
Propionic acid (Cat No.: R020108) is a naturally occurring carboxylic acid. It is a colorless, pungent-smelling liquid that is miscible with water and commonly used as a preservative in food and animal feed due to its antimicrobial properties. In industrial applications, it serves as an intermediate in the production of herbicides, pharmaceuticals, and cellulose-based plastics. Propionic acid is also a byproduct of bacterial fermentation and plays a role in metabolic processes within the human gut microbiome.
| CAS Number | 79-09-4 |
| Synonyms | Adofeed; Antischim B; Carboxyethane; Ethanecarboxylic Acid; Ethylformic Acid; Luprosil; Metacetonic Acid; Methylacetic Acid; MonoProp; Propcorn; Propkorn; Prozoin; Pseudoacetic Acid; Toxi-Check; Propanoic Acid |
| Molecular Formula | C3H6O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | propanoic acid |
| InChI | InChI=1S/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5) |
| InChIKey | XBDQKXXYIPTUBI-UHFFFAOYSA-N |
| SMILES | CCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
