For research use only. Not for therapeutic Use.
Propionamidine hydrochloride（Cat No.:R073886）is a white crystalline compound composed of a propionamidine core and a hydrochloride counterion, enhancing its stability and solubility in aqueous solutions. It serves as a valuable reagent in biochemical and pharmaceutical research, particularly in the synthesis of amidine-containing molecules and as a precursor in drug development. Its guanidine-like structure allows it to interact with nucleophilic biological targets. This compound is typically stable under ambient conditions but should be stored in a dry, sealed container. Standard laboratory precautions are recommended to prevent irritation from inhalation or skin contact.
| CAS Number | 3599-89-1 |
| Molecular Formula | C3H9ClN2 |
| Purity | ≥95% |
| IUPAC Name | propanimidamide;hydrochloride |
| InChI | InChI=1S/C3H8N2.ClH/c1-2-3(4)5;/h2H2,1H3,(H3,4,5);1H |
| InChIKey | DFWRZHZPJJAJMX-UHFFFAOYSA-N |
| SMILES | CCC(=N)N.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
