For research use only. Not for therapeutic Use.
Propionamide（Cat No.:R069674）is a simple organic compound with the formula C₂H₅CONH₂, consisting of a propionyl group attached to an amide functional group. It appears as a white crystalline solid and is soluble in water and ethanol. Propionamide is primarily used as an intermediate in organic synthesis, including pharmaceuticals, agrochemicals, and polymer production. Its amide group allows it to participate in hydrogen bonding, influencing its reactivity and physical properties. Additionally, it serves as a starting material in the preparation of more complex amide derivatives, making it valuable in research and industrial applications.
| CAS Number | 79-05-0 |
| Synonyms | Propanamide |
| Molecular Formula | CH3CH2CONH2 |
| Purity | ≥95% |
| Documentation |
CoA-79-05-0-M22X10110_1129.pdf |
| Storage | RT |
| IUPAC Name | propanamide |
| InChI | InChI=1S/C3H7NO/c1-2-3(4)5/h2H2,1H3,(H2,4,5) |
| InChIKey | QLNJFJADRCOGBJ-UHFFFAOYSA-N |
| SMILES | CCC(=O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
