For research use only. Not for therapeutic Use.
Propargyl-PEG4-NHS Ester(CAT: I014621) is a reactive chemical linker commonly used in bioconjugation and click chemistry applications. It features a propargyl group that enables copper-catalyzed azide-alkyne cycloaddition (CuAAC) reactions and an N-hydroxysuccinimide (NHS) ester for efficient amine-reactive conjugation. The PEG4 spacer enhances solubility and flexibility, reducing steric hindrance in conjugated biomolecules. Propargyl-PEG4-NHS Ester is widely used in chemical biology and drug delivery research, supporting the development of targeted therapeutics, imaging probes, and biomolecule labeling. Its versatility and reliability make it a critical tool for advanced bioconjugation techniques in diverse experimental and therapeutic contexts.
| CAS Number | 1428629-70-2 |
| Synonyms | Propargyl-PEG4-NHS ester;Propargyl-PEG4-NHS ester |
| Molecular Formula | C16H23NO8 |
| Purity | ≥95% |
| Target | ADC Linker |
| Solubility | Soluble in DMSO |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]propanoate |
| InChI | InChI=1S/C12H19O6.C4H4NO2/c1-2-4-15-6-8-17-10-11-18-9-7-16-5-3-12(13)14;6-3-1-2-4(7)5-3/h1H,3-11H2;1-2H2 |
| InChIKey | WMBISYJCYQJEQK-UHFFFAOYSA-N |
| SMILES | [O]C(CCOCCOCCOCCOCC#C)=O.O=C1[N]C(CC1)=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |