For research use only. Not for therapeutic Use.
Propargyl-PEG4-Boc（Cat No.:I014623）is a multifunctional PEG-based linker designed for orthogonal and controlled conjugation strategies. It features a terminal propargyl group that undergoes efficient click chemistry with azides via copper-catalyzed or strain-promoted cycloaddition, enabling site-specific modifications. The Boc-protected amine offers controlled deprotection for subsequent coupling to biomolecules, peptides, or polymers. The PEG4 spacer enhances solubility, provides flexibility, and reduces steric hindrance, ensuring compatibility with complex biological systems. This reagent is highly useful in drug delivery, diagnostic probe construction, chemical biology, and multifunctional conjugate synthesis where precision and modular assembly are essential.
| CAS Number | 1355197-66-8 |
| Synonyms | tert-butyl 3-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]propanoate |
| Molecular Formula | C16H28O6 |
| Purity | ≥95% |
| IUPAC Name | tert-butyl 3-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]propanoate |
| InChI | InChI=1S/C16H28O6/c1-5-7-18-9-11-20-13-14-21-12-10-19-8-6-15(17)22-16(2,3)4/h1H,6-14H2,2-4H3 4H3 |
| InChIKey | BEQLPTKRFULADF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCC#C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
