For research use only. Not for therapeutic Use.
Propargyl-PEG2-β-D-glucose(CAT: I045967) is a functionalized glucose derivative featuring a β-D-glucose moiety linked through a short PEG2 spacer to a terminal propargyl group. The propargyl functionality enables bioorthogonal copper-catalyzed azide–alkyne cycloaddition (CuAAC) “click” chemistry, allowing selective conjugation to azide-containing molecules. The PEG2 linker enhances solubility, flexibility, and reduces steric hindrance, while the glucose unit provides a biologically relevant recognition motif. This reagent is widely employed in glycobiology, chemical biology, and drug delivery research, supporting the development of glyco-conjugates, targeted probes, and functionalized biomaterials. Its defined structure offers precision in studying carbohydrate-mediated interactions and metabolic labeling.
| CAS Number | 2353409-73-9 |
| Synonyms | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[2-(2-prop-2-ynoxyethoxy)ethoxy]oxane-3,4,5-triol |
| Molecular Formula | C13H22O8 |
| Purity | ≥95% |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[2-(2-prop-2-ynoxyethoxy)ethoxy]oxane-3,4,5-triol |
| InChI | InChI=1S/C13H22O8/c1-2-3-18-4-5-19-6-7-20-13-12(17)11(16)10(15)9(8-14)21-13/h1,9-17H,3-8H2/t9-,10-,11+,12-,13-/m1/s1 |
| InChIKey | VCAWUMOFEKQAES-UJPOAAIJSA-N |
| SMILES | C#CCOCCOCCOC1C(C(C(C(O1)CO)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
