For research use only. Not for therapeutic Use.
Propargyl-PEG1-acid (Cat No.: I014592) is a bifunctional polyethylene glycol (PEG) linker featuring a terminal propargyl (alkyne) group and a carboxylic acid group. It is commonly used in bioconjugation, click chemistry, and surface modification. The alkyne moiety enables copper-catalyzed azide-alkyne cycloaddition (CuAAC) reactions, allowing efficient and specific attachment to azide-labeled molecules. The carboxylic acid end facilitates coupling to amine-containing biomolecules via carbodiimide chemistry. Propargyl-PEG1-acid improves solubility, reduces steric hindrance, and enhances stability in drug delivery, diagnostics, and biomaterials development applications.
| CAS Number | 55683-37-9 |
| Synonyms | Propargyl-PEG1-acid;3-(2-Propynyloxy)propanoic acid |
| Molecular Formula | C6H8O3 |
| Purity | ≥95% |
| Target | PROTAC Linkers |
| Solubility | Soluble in DMSO |
| InChI | InChI=1S/C6H8O3/c1-2-4-9-5-3-6(7)8/h1H,3-5H2,(H,7,8) |
| InChIKey | GMFDYXLFHSFUHE-UHFFFAOYSA-N |
| SMILES | O=C(O)CCOCC#C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
