For research use only. Not for therapeutic Use.
Propafenone（Cat No.:I045025）is a Class 1C antiarrhythmic agent used to treat and prevent supraventricular and ventricular arrhythmias. It works by blocking fast sodium channels in cardiac muscle, slowing conduction and stabilizing the cardiac action potential. Additionally, propafenone has beta-adrenergic blocking and mild calcium channel blocking effects, contributing to its antiarrhythmic efficacy. It is metabolized primarily in the liver and exhibits variable pharmacokinetics due to genetic polymorphisms in CYP2D6. Propafenone is commonly studied for its effects on cardiac electrophysiology, rhythm stabilization, and its potential interactions with other cardiovascular drugs.
| CAS Number | 54063-53-5 |
| Synonyms | 1-[2-[2-hydroxy-3-(propylamino)propoxy]phenyl]-3-phenylpropan-1-one |
| Molecular Formula | C21H27NO3 |
| Purity | ≥95% |
| IUPAC Name | 1-[2-[2-hydroxy-3-(propylamino)propoxy]phenyl]-3-phenylpropan-1-one |
| InChI | InChI=1S/C21H27NO3/c1-2-14-22-15-18(23)16-25-21-11-7-6-10-19(21)20(24)13-12-17-8-4-3-5-9-17/h3-11,18,22-23H,2,12-16H2,1H3 |
| InChIKey | JWHAUXFOSRPERK-UHFFFAOYSA-N |
| SMILES | CCCNCC(COC1=CC=CC=C1C(=O)CCC2=CC=CC=C2)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
