Prolintane is a stimulant drug that was originally developed to combat fatigue and enhance cognitive function. Structurally related to amphetamines, Prolintane works by increasing levels of dopamine and norepinephrine in the brain, leading to heightened alertness, improved concentration, and reduced tiredness. It has been used clinically for treating conditions like narcolepsy and in elderly patients to improve mental acuity. However, due to its stimulant properties, Prolintane has a potential for abuse and dependence, leading to its regulation in many countries. It remains a subject of interest in research on cognitive enhancers.
Catalog Number | R056462 |
CAS Number | 493-92-5 |
Synonyms | 1-[1-(Phenylmethyl)butyl]pyrrolidine; 1-(1-Benzylbutyl)pyrrolidine; 1-(α-Propylphenethyl)pyrrolidine;1-Phenyl-2-pyrrolidinylpentane; Phenylpyrrolidinopentane; Prolintan; |
Molecular Formula | C15H23N |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 1-(1-phenylpentan-2-yl)pyrrolidine |
InChI | InChI=1S/C15H23N/c1-2-8-15(16-11-6-7-12-16)13-14-9-4-3-5-10-14/h3-5,9-10,15H,2,6-8,11-13H2,1H3 |
InChIKey | OJCPSBCUMRIPFL-UHFFFAOYSA-N |
SMILES | CCCC(CC1=CC=CC=C1)N2CCCC2 |