Prohydrojasmon - CAS 158474-72-7
Prohydrojasmon(Cat No.:H000071), is a synthetic compound used in agriculture as a plant growth regulator and stress response elicitor. It is a derivative of jasmonic acid, a natural plant hormone involved in various physiological processes, including plant defense mechanisms. Prohydrojasmon is applied to crops to induce stress responses that can enhance resistance to pests, pathogens, and environmental stressors. It can also promote certain aspects of plant growth, such as root development and fruit ripening.
Catalog Number: H000071
CAS Number: 158474-72-7
Molecular Formula: C15H26O3
Molecular Weight:254.37
Purity: ≥95%
* For research use only. Not for human or veterinary use.
Property
Molecular Formula: | C15H26O3 |
---|---|
Molecular Weight | 254.37 |
Purity | ≥95% |
Storage | 0-6°C |
Computed Descriptor
IUPAC Name | propyl 2-(3-oxo-2-pentylcyclopentyl)acetate |
---|---|
InChI | InChI=1S/C15H26O3/c1-3-5-6-7-13-12(8-9-14(13)16)11-15(17)18-10-4-2/h12-13H,3-11H2,1-2H3 |
InChIKey | IPDFPNNPBMREIF-UHFFFAOYSA-N |
SMILES | CCCCCC1C(CCC1=O)CC(=O)OCCC |